C21H16N10O — CID 169381175
[5,7-diamino-6-cyano-4-(2-hydroxy-5-phenyldiazenylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381175) has the molecular formula C21H16N10O and a molecular weight of 424.43 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(2-hydroxy-5-phenyldiazenylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(2-hydroxy-5-phenyldiazenylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381175 |
| Molecular Formula | C21H16N10O |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(2-hydroxy-5-phenyldiazenylphenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | N#CNC1=NC(c2cc(/N=N/c3ccccc3)ccc2O)c2c(nc(N)c(C#N)c2N)N1 |
| InChI | InChI=1S/C21H16N10O/c22-9-14-17(24)16-18(27-21(26-10-23)29-20(16)28-19(14)25)13-8-12(6-7-15(13)32)31-30-11-4-2-1-3-5-11/h1-8,18,32H,(H6,24,25,26,27,28,29)/b31-30+ |
| InChIKey | XFJIKEABHQGRQT-NVQSTNCTSA-N |
| XLogP | 3.18 |
| TPSA | 193.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|