C16H15N9O — CID 169381029
[5,7-diamino-6-cyano-4-[2-hydroxy-6-(methylamino)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169381029) has the molecular formula C16H15N9O and a molecular weight of 349.36 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-[2-hydroxy-6-(methylamino)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-[2-hydroxy-6-(methylamino)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169381029 |
| Molecular Formula | C16H15N9O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [5,7-diamino-6-cyano-4-[2-hydroxy-6-(methylamino)phenyl]-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | CNc1cccc(O)c1C1N=C(NC#N)Nc2nc(N)c(C#N)c(N)c21 |
| InChI | InChI=1S/C16H15N9O/c1-21-8-3-2-4-9(26)10(8)13-11-12(19)7(5-17)14(20)24-15(11)25-16(23-13)22-6-18/h2-4,13,21,26H,1H3,(H6,19,20,22,23,24,25) |
| InChIKey | SFPPGYOYPWPYKT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 181.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|