C17H11FN8 — CID 169380937
[5,7-diamino-6-cyano-4-(2-ethynyl-6-fluorophenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380937) has the molecular formula C17H11FN8 and a molecular weight of 346.33 g/mol. Its IUPAC name is [5,7-diamino-6-cyano-4-(2-ethynyl-6-fluorophenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-6-cyano-4-(2-ethynyl-6-fluorophenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380937 |
| Molecular Formula | C17H11FN8 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [5,7-diamino-6-cyano-4-(2-ethynyl-6-fluorophenyl)-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | C#Cc1cccc(F)c1C1N=C(NC#N)Nc2nc(N)c(C#N)c(N)c21 |
| InChI | InChI=1S/C17H11FN8/c1-2-8-4-3-5-10(18)11(8)14-12-13(21)9(6-19)15(22)25-16(12)26-17(24-14)23-7-20/h1,3-5,14H,(H6,21,22,23,24,25,26) |
| InChIKey | QSPZEJQFEOFABQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|