C18H14BrIN8O — CID 169380615
[5,7-diamino-4-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide (PubChem CID 169380615) has the molecular formula C18H14BrIN8O and a molecular weight of 565.17 g/mol. Its IUPAC name is [5,7-diamino-4-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide.
| Compound Name | [5,7-diamino-4-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
|---|---|
| PubChem CID | 169380615 |
| Molecular Formula | C18H14BrIN8O |
| Molecular Weight | 565.17 g/mol |
| Exact Mass | 563.95 |
| IUPAC Name | [5,7-diamino-4-(5-bromo-3-iodo-2-prop-2-enoxyphenyl)-6-cyano-1,4-dihydropyrido[2,3-d]pyrimidin-2-yl]cyanamide |
| SMILES | C=CCOc1c(I)cc(Br)cc1C1N=C(NC#N)Nc2nc(N)c(C#N)c(N)c21 |
| InChI | InChI=1S/C18H14BrIN8O/c1-2-3-29-15-9(4-8(19)5-11(15)20)14-12-13(23)10(6-21)16(24)27-17(12)28-18(26-14)25-7-22/h2,4-5,14H,1,3H2,(H6,23,24,25,26,27,28) |
| InChIKey | KQOUVBTURJTIOX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 158.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.17 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|