C17H19BrN4O2S — CID 90481417
2,6-diamino-4-(5-bromo-2-ethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile;ethanol (PubChem CID 90481417) has the molecular formula C17H19BrN4O2S and a molecular weight of 423.34 g/mol. Its IUPAC name is 2,6-diamino-4-(5-bromo-2-ethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile;ethanol.
| Compound Name | 2,6-diamino-4-(5-bromo-2-ethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile;ethanol |
|---|---|
| PubChem CID | 90481417 |
| Molecular Formula | C17H19BrN4O2S |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.04 |
| IUPAC Name | 2,6-diamino-4-(5-bromo-2-ethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile;ethanol |
| SMILES | CCO.CCOc1ccc(Br)cc1C1C(C#N)=C(N)SC(N)=C1C#N |
| InChI | InChI=1S/C15H13BrN4OS.C2H6O/c1-2-21-12-4-3-8(16)5-9(12)13-10(6-17)14(19)22-15(20)11(13)7-18;1-2-3/h3-5,13H,2,19-20H2,1H3;3H,2H2,1H3 |
| InChIKey | XKGPTRFAWDCKCO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|