C17H18N4O2S — CID 2218392
2,6-diamino-4-(2,5-diethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 2218392) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2,6-diamino-4-(2,5-diethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile.
| Compound Name | 2,6-diamino-4-(2,5-diethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 2218392 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2,6-diamino-4-(2,5-diethoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | CCOc1ccc(OCC)c(C2C(C#N)=C(N)SC(N)=C2C#N)c1 |
| InChI | InChI=1S/C17H18N4O2S/c1-3-22-10-5-6-14(23-4-2)11(7-10)15-12(8-18)16(20)24-17(21)13(15)9-19/h5-7,15H,3-4,20-21H2,1-2H3 |
| InChIKey | GWPIUNSAPKASSU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|