C20H23N5O3S — CID 11838757
2-[4-(2,6-diamino-3,5-dicyano-4H-thiopyran-4-yl)-2-methoxyphenoxy]-N,N-diethylacetamide (PubChem CID 11838757) has the molecular formula C20H23N5O3S and a molecular weight of 413.50 g/mol. Its IUPAC name is 2-[4-(2,6-diamino-3,5-dicyano-4H-thiopyran-4-yl)-2-methoxyphenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[4-(2,6-diamino-3,5-dicyano-4H-thiopyran-4-yl)-2-methoxyphenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 11838757 |
| Molecular Formula | C20H23N5O3S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[4-(2,6-diamino-3,5-dicyano-4H-thiopyran-4-yl)-2-methoxyphenoxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1ccc(C2C(C#N)=C(N)SC(N)=C2C#N)cc1OC |
| InChI | InChI=1S/C20H23N5O3S/c1-4-25(5-2)17(26)11-28-15-7-6-12(8-16(15)27-3)18-13(9-21)19(23)29-20(24)14(18)10-22/h6-8,18H,4-5,11,23-24H2,1-3H3 |
| InChIKey | HSDFSOFFLLGIBK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'} |
|---|