C18H20N4O2S — CID 5229918
2,6-diamino-4-(3-butoxy-4-methoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile (PubChem CID 5229918) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2,6-diamino-4-(3-butoxy-4-methoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile.
| Compound Name | 2,6-diamino-4-(3-butoxy-4-methoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 5229918 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2,6-diamino-4-(3-butoxy-4-methoxyphenyl)-4H-thiopyran-3,5-dicarbonitrile |
| SMILES | CCCCOc1cc(C2C(C#N)=C(N)SC(N)=C2C#N)ccc1OC |
| InChI | InChI=1S/C18H20N4O2S/c1-3-4-7-24-15-8-11(5-6-14(15)23-2)16-12(9-19)17(21)25-18(22)13(16)10-20/h5-6,8,16H,3-4,7,21-22H2,1-2H3 |
| InChIKey | IEHKQKIGUVJWJG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 118.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_bis_amino_CN(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|