C26H25ClN4O5 — CID 4692754
2-amino-1-(2-chloro-5-nitrophenyl)-4-(2,5-diethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 4692754) has the molecular formula C26H25ClN4O5 and a molecular weight of 508.96 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-5-nitrophenyl)-4-(2,5-diethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-1-(2-chloro-5-nitrophenyl)-4-(2,5-diethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 4692754 |
| Molecular Formula | C26H25ClN4O5 |
| Molecular Weight | 508.96 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 2-amino-1-(2-chloro-5-nitrophenyl)-4-(2,5-diethoxyphenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | CCOc1ccc(OCC)c(C2C(C#N)=C(N)N(c3cc([N+](=O)[O-])ccc3Cl)C3=C2C(=O)CCC3)c1 |
| InChI | InChI=1S/C26H25ClN4O5/c1-3-35-16-9-11-23(36-4-2)17(13-16)24-18(14-28)26(29)30(20-6-5-7-22(32)25(20)24)21-12-15(31(33)34)8-10-19(21)27/h8-13,24H,3-7,29H2,1-2H3 |
| InChIKey | CRLAFJGFUGZVSX-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.96 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|