C24H25ClN4O4S — CID 126477450
2-amino-1-(2-chloro-4-nitrophenyl)-4-(2,5-dimethylthiophen-3-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile;ethanol (PubChem CID 126477450) has the molecular formula C24H25ClN4O4S and a molecular weight of 501.01 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-4-nitrophenyl)-4-(2,5-dimethylthiophen-3-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile;ethanol.
| Compound Name | 2-amino-1-(2-chloro-4-nitrophenyl)-4-(2,5-dimethylthiophen-3-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile;ethanol |
|---|---|
| PubChem CID | 126477450 |
| Molecular Formula | C24H25ClN4O4S |
| Molecular Weight | 501.01 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 2-amino-1-(2-chloro-4-nitrophenyl)-4-(2,5-dimethylthiophen-3-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile;ethanol |
| SMILES | CCO.Cc1cc(C2C(C#N)=C(N)N(c3ccc([N+](=O)[O-])cc3Cl)C3=C2C(=O)CCC3)c(C)s1 |
| InChI | InChI=1S/C22H19ClN4O3S.C2H6O/c1-11-8-14(12(2)31-11)20-15(10-24)22(25)26(18-4-3-5-19(28)21(18)20)17-7-6-13(27(29)30)9-16(17)23;1-2-3/h6-9,20H,3-5,25H2,1-2H3;3H,2H2,1H3 |
| InChIKey | JLCQTRKESAQUNK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 133.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.01 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|