C21H17N5O5S — CID 5304482
2-amino-1-(2-methyl-5-nitrophenyl)-4-(5-nitrothiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 5304482) has the molecular formula C21H17N5O5S and a molecular weight of 451.46 g/mol. Its IUPAC name is 2-amino-1-(2-methyl-5-nitrophenyl)-4-(5-nitrothiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-1-(2-methyl-5-nitrophenyl)-4-(5-nitrothiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5304482 |
| Molecular Formula | C21H17N5O5S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 2-amino-1-(2-methyl-5-nitrophenyl)-4-(5-nitrothiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1ccc([N+](=O)[O-])cc1N1C(N)=C(C#N)C(c2ccc([N+](=O)[O-])s2)C2=C1CCCC2=O |
| InChI | InChI=1S/C21H17N5O5S/c1-11-5-6-12(25(28)29)9-15(11)24-14-3-2-4-16(27)20(14)19(13(10-22)21(24)23)17-7-8-18(32-17)26(30)31/h5-9,19H,2-4,23H2,1H3 |
| InChIKey | QDCXTIXLWLVILH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 156.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|