C22H18ClN5O5S — CID 42578836
(4R)-2-amino-1-(2-chloro-5-nitrophenyl)-7,7-dimethyl-4-(5-nitrothiophen-2-yl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 42578836) has the molecular formula C22H18ClN5O5S and a molecular weight of 499.94 g/mol. Its IUPAC name is (4R)-2-amino-1-(2-chloro-5-nitrophenyl)-7,7-dimethyl-4-(5-nitrothiophen-2-yl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | (4R)-2-amino-1-(2-chloro-5-nitrophenyl)-7,7-dimethyl-4-(5-nitrothiophen-2-yl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 42578836 |
| Molecular Formula | C22H18ClN5O5S |
| Molecular Weight | 499.94 g/mol |
| Exact Mass | 499.07 |
| IUPAC Name | (4R)-2-amino-1-(2-chloro-5-nitrophenyl)-7,7-dimethyl-4-(5-nitrothiophen-2-yl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1cc([N+](=O)[O-])ccc1Cl)C(N)=C(C#N)[C@H]2c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C22H18ClN5O5S/c1-22(2)8-15-20(16(29)9-22)19(17-5-6-18(34-17)28(32)33)12(10-24)21(25)26(15)14-7-11(27(30)31)3-4-13(14)23/h3-7,19H,8-9,25H2,1-2H3/t19-/m0/s1 |
| InChIKey | UQBDCHYNOTUHAA-IBGZPJMESA-N |
| XLogP | 5.16 |
| TPSA | 156.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.94 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|