C33H32N4O3S — CID 5010374
2-amino-4-[2,4-dimethyl-5-[(4-methylphenyl)sulfanylmethyl]phenyl]-1-(2-methyl-5-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 5010374) has the molecular formula C33H32N4O3S and a molecular weight of 564.71 g/mol. Its IUPAC name is 2-amino-4-[2,4-dimethyl-5-[(4-methylphenyl)sulfanylmethyl]phenyl]-1-(2-methyl-5-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-[2,4-dimethyl-5-[(4-methylphenyl)sulfanylmethyl]phenyl]-1-(2-methyl-5-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5010374 |
| Molecular Formula | C33H32N4O3S |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | 2-amino-4-[2,4-dimethyl-5-[(4-methylphenyl)sulfanylmethyl]phenyl]-1-(2-methyl-5-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1ccc(SCc2cc(C3C(C#N)=C(N)N(c4cc([N+](=O)[O-])ccc4C)C4=C3C(=O)CCC4)c(C)cc2C)cc1 |
| InChI | InChI=1S/C33H32N4O3S/c1-19-8-12-25(13-9-19)41-18-23-15-26(22(4)14-21(23)3)31-27(17-34)33(35)36(28-6-5-7-30(38)32(28)31)29-16-24(37(39)40)11-10-20(29)2/h8-16,31H,5-7,18,35H2,1-4H3 |
| InChIKey | WVGMCQQKPBSKJI-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|