C20H15FN4O3S — CID 7327966
(4S)-2-amino-1-(2-fluorophenyl)-4-(5-nitrothiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 7327966) has the molecular formula C20H15FN4O3S and a molecular weight of 410.43 g/mol. Its IUPAC name is (4S)-2-amino-1-(2-fluorophenyl)-4-(5-nitrothiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-2-amino-1-(2-fluorophenyl)-4-(5-nitrothiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 7327966 |
| Molecular Formula | C20H15FN4O3S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (4S)-2-amino-1-(2-fluorophenyl)-4-(5-nitrothiophen-2-yl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#CC1=C(N)N(c2ccccc2F)C2=C(C(=O)CCC2)[C@H]1c1ccc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C20H15FN4O3S/c21-12-4-1-2-5-13(12)24-14-6-3-7-15(26)19(14)18(11(10-22)20(24)23)16-8-9-17(29-16)25(27)28/h1-2,4-5,8-9,18H,3,6-7,23H2/t18-/m1/s1 |
| InChIKey | HNCAILZBNKIXIS-GOSISDBHSA-N |
| XLogP | 4.10 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|