C15H21NO2 — CID 83942836
4-(2,5-diethoxyphenyl)pentanenitrile (PubChem CID 83942836) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 4-(2,5-diethoxyphenyl)pentanenitrile.
| Compound Name | 4-(2,5-diethoxyphenyl)pentanenitrile |
|---|---|
| PubChem CID | 83942836 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 4-(2,5-diethoxyphenyl)pentanenitrile |
| SMILES | CCOc1ccc(OCC)c(C(C)CCC#N)c1 |
| InChI | InChI=1S/C15H21NO2/c1-4-17-13-8-9-15(18-5-2)14(11-13)12(3)7-6-10-16/h8-9,11-12H,4-7H2,1-3H3 |
| InChIKey | FPPFNHISRAXJHB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |