C14H21ClO2 — CID 83942775
2-(4-chlorobutan-2-yl)-1,4-diethoxybenzene (PubChem CID 83942775) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is 2-(4-chlorobutan-2-yl)-1,4-diethoxybenzene.
| Compound Name | 2-(4-chlorobutan-2-yl)-1,4-diethoxybenzene |
|---|---|
| PubChem CID | 83942775 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-(4-chlorobutan-2-yl)-1,4-diethoxybenzene |
| SMILES | CCOc1ccc(OCC)c(C(C)CCCl)c1 |
| InChI | InChI=1S/C14H21ClO2/c1-4-16-12-6-7-14(17-5-2)13(10-12)11(3)8-9-15/h6-7,10-11H,4-5,8-9H2,1-3H3 |
| InChIKey | CQLRJYZOQMHSPM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|