C20H20N2O4 — CID 4675437
2-amino-4-(2,5-diethoxyphenyl)-6-hydroxy-4H-chromene-3-carbonitrile (PubChem CID 4675437) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-amino-4-(2,5-diethoxyphenyl)-6-hydroxy-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(2,5-diethoxyphenyl)-6-hydroxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 4675437 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-amino-4-(2,5-diethoxyphenyl)-6-hydroxy-4H-chromene-3-carbonitrile |
| SMILES | CCOc1ccc(OCC)c(C2C(C#N)=C(N)Oc3ccc(O)cc32)c1 |
| InChI | InChI=1S/C20H20N2O4/c1-3-24-13-6-8-17(25-4-2)15(10-13)19-14-9-12(23)5-7-18(14)26-20(22)16(19)11-21/h5-10,19,23H,3-4,22H2,1-2H3 |
| InChIKey | GWHAZQPSPQOODT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 97.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |