C20H12ClN3O4 — CID 3688830
2-amino-4-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)-7-hydroxy-4H-chromene-3-carbonitrile (PubChem CID 3688830) has the molecular formula C20H12ClN3O4 and a molecular weight of 393.79 g/mol. Its IUPAC name is 2-amino-4-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)-7-hydroxy-4H-chromene-3-carbonitrile.
| Compound Name | 2-amino-4-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)-7-hydroxy-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 3688830 |
| Molecular Formula | C20H12ClN3O4 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2-amino-4-(6-chloro-[1,3]dioxolo[4,5-g]quinolin-7-yl)-7-hydroxy-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(O)ccc2C1c1cc2cc3c(cc2nc1Cl)OCO3 |
| InChI | InChI=1S/C20H12ClN3O4/c21-19-12(3-9-4-16-17(27-8-26-16)6-14(9)24-19)18-11-2-1-10(25)5-15(11)28-20(23)13(18)7-22/h1-6,18,25H,8,23H2 |
| InChIKey | CFQQOQZGTMJJFK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|