C17H11N3O6 — CID 8613702
(4R)-2-amino-7-hydroxy-4-(6-nitro-1,3-benzodioxol-5-yl)-4H-chromene-3-carbonitrile (PubChem CID 8613702) has the molecular formula C17H11N3O6 and a molecular weight of 353.29 g/mol. Its IUPAC name is (4R)-2-amino-7-hydroxy-4-(6-nitro-1,3-benzodioxol-5-yl)-4H-chromene-3-carbonitrile.
| Compound Name | (4R)-2-amino-7-hydroxy-4-(6-nitro-1,3-benzodioxol-5-yl)-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 8613702 |
| Molecular Formula | C17H11N3O6 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | (4R)-2-amino-7-hydroxy-4-(6-nitro-1,3-benzodioxol-5-yl)-4H-chromene-3-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc(O)ccc2[C@H]1c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C17H11N3O6/c18-6-11-16(9-2-1-8(21)3-13(9)26-17(11)19)10-4-14-15(25-7-24-14)5-12(10)20(22)23/h1-5,16,21H,7,19H2/t16-/m0/s1 |
| InChIKey | DCYUBUJWTMREKL-INIZCTEOSA-N |
| XLogP | 2.25 |
| TPSA | 140.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|