C24H15I2N3O6 — CID 126104590
(8R)-6-amino-8-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile (PubChem CID 126104590) has the molecular formula C24H15I2N3O6 and a molecular weight of 695.21 g/mol. Its IUPAC name is (8R)-6-amino-8-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile.
| Compound Name | (8R)-6-amino-8-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile |
|---|---|
| PubChem CID | 126104590 |
| Molecular Formula | C24H15I2N3O6 |
| Molecular Weight | 695.21 g/mol |
| Exact Mass | 694.91 |
| IUPAC Name | (8R)-6-amino-8-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc3c(cc2[C@H]1c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(I)c1)OCO3 |
| InChI | InChI=1S/C24H15I2N3O6/c25-17-5-13(6-18(26)23(17)32-10-12-1-3-14(4-2-12)29(30)31)22-15-7-20-21(34-11-33-20)8-19(15)35-24(28)16(22)9-27/h1-8,22H,10-11,28H2/t22-/m1/s1 |
| InChIKey | KTORCCYTRLVZNB-JOCHJYFZSA-N |
| XLogP | 5.33 |
| TPSA | 129.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.21 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|