C24H15BrI2N2O4 — CID 126101257
(8R)-6-amino-8-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile (PubChem CID 126101257) has the molecular formula C24H15BrI2N2O4 and a molecular weight of 729.11 g/mol. Its IUPAC name is (8R)-6-amino-8-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile.
| Compound Name | (8R)-6-amino-8-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile |
|---|---|
| PubChem CID | 126101257 |
| Molecular Formula | C24H15BrI2N2O4 |
| Molecular Weight | 729.11 g/mol |
| Exact Mass | 727.83 |
| IUPAC Name | (8R)-6-amino-8-[4-[(4-bromophenyl)methoxy]-3,5-diiodophenyl]-8H-[1,3]dioxolo[4,5-g]chromene-7-carbonitrile |
| SMILES | N#CC1=C(N)Oc2cc3c(cc2[C@H]1c1cc(I)c(OCc2ccc(Br)cc2)c(I)c1)OCO3 |
| InChI | InChI=1S/C24H15BrI2N2O4/c25-14-3-1-12(2-4-14)10-30-23-17(26)5-13(6-18(23)27)22-15-7-20-21(32-11-31-20)8-19(15)33-24(29)16(22)9-28/h1-8,22H,10-11,29H2/t22-/m1/s1 |
| InChIKey | GHACMVWXJIBGRH-JOCHJYFZSA-N |
| XLogP | 6.18 |
| TPSA | 86.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.11 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|