C24H18Cl2N2O6S — CID 171336757
[2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-4H-chromen-7-yl] 3,4-dichlorobenzenesulfonate (PubChem CID 171336757) has the molecular formula C24H18Cl2N2O6S and a molecular weight of 533.39 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-4H-chromen-7-yl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-4H-chromen-7-yl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 171336757 |
| Molecular Formula | C24H18Cl2N2O6S |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | [2-amino-3-cyano-4-(3,4-dimethoxyphenyl)-4H-chromen-7-yl] 3,4-dichlorobenzenesulfonate |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3cc(OS(=O)(=O)c4ccc(Cl)c(Cl)c4)ccc32)cc1OC |
| InChI | InChI=1S/C24H18Cl2N2O6S/c1-31-20-8-3-13(9-22(20)32-2)23-16-6-4-14(10-21(16)33-24(28)17(23)12-27)34-35(29,30)15-5-7-18(25)19(26)11-15/h3-11,23H,28H2,1-2H3 |
| InChIKey | KNZXKNVRHZGFJR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 120.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|