C15H16IN3O2 — CID 90486012
5-acetyl-6-amino-2-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-pyran-3-carbonitrile iodide (PubChem CID 90486012) has the molecular formula C15H16IN3O2 and a molecular weight of 397.22 g/mol. Its IUPAC name is 5-acetyl-6-amino-2-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-pyran-3-carbonitrile iodide.
| Compound Name | 5-acetyl-6-amino-2-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-pyran-3-carbonitrile iodide |
|---|---|
| PubChem CID | 90486012 |
| Molecular Formula | C15H16IN3O2 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 5-acetyl-6-amino-2-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-pyran-3-carbonitrile iodide |
| SMILES | CC(=O)C1=C(N)OC(C)=C(C#N)C1c1ccc[n+](C)c1.[I-] |
| InChI | InChI=1S/C15H15N3O2.HI/c1-9(19)13-14(11-5-4-6-18(3)8-11)12(7-16)10(2)20-15(13)17;/h4-6,8,14H,1-3H3,(H-,17,19);1H |
| InChIKey | IMBNNUNBBUTWSU-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 79.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|