C14H13IN4S — CID 44656423
2-amino-6-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-thiopyran-3,5-dicarbonitrile iodide (PubChem CID 44656423) has the molecular formula C14H13IN4S and a molecular weight of 396.26 g/mol. Its IUPAC name is 2-amino-6-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-thiopyran-3,5-dicarbonitrile iodide.
| Compound Name | 2-amino-6-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-thiopyran-3,5-dicarbonitrile iodide |
|---|---|
| PubChem CID | 44656423 |
| Molecular Formula | C14H13IN4S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-amino-6-methyl-4-(1-methylpyridin-1-ium-3-yl)-4H-thiopyran-3,5-dicarbonitrile iodide |
| SMILES | CC1=C(C#N)C(c2ccc[n+](C)c2)C(C#N)=C(N)S1.[I-] |
| InChI | InChI=1S/C14H13N4S.HI/c1-9-11(6-15)13(12(7-16)14(17)19-9)10-4-3-5-18(2)8-10;/h3-5,8,13H,17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | AFZMEQGSHBYSTR-UHFFFAOYSA-M |
| XLogP | -1.16 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|