C24H30O2 — CID 102379862
ethyl (1S,2S,5R,6S)-7-hexyl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate (PubChem CID 102379862) has the molecular formula C24H30O2 and a molecular weight of 350.50 g/mol. Its IUPAC name is ethyl (1S,2S,5R,6S)-7-hexyl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate.
| Compound Name | ethyl (1S,2S,5R,6S)-7-hexyl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate |
|---|---|
| PubChem CID | 102379862 |
| Molecular Formula | C24H30O2 |
| Molecular Weight | 350.50 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | ethyl (1S,2S,5R,6S)-7-hexyl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-3-carboxylate |
| SMILES | CCCCCCC1=C[C@@H]2C[C@H]1[C@H]1C(c3ccccc3)=C(C(=O)OCC)[C@H]12 |
| InChI | InChI=1S/C24H30O2/c1-3-5-6-8-13-17-14-18-15-19(17)22-20(16-11-9-7-10-12-16)23(21(18)22)24(25)26-4-2/h7,9-12,14,18-19,21-22H,3-6,8,13,15H2,1-2H3/t18-,19-,21+,22+/m1/s1 |
| InChIKey | JTDXHGJUIFYWFM-WKDRNLAYSA-N |
| XLogP | 5.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.50 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|