C19H20O4 — CID 101103644
ethyl (1S,2R,6S,7S,9S)-9-hydroxy-5-oxo-4-phenyltricyclo[5.2.1.02,6]dec-3-ene-3-carboxylate (PubChem CID 101103644) has the molecular formula C19H20O4 and a molecular weight of 312.37 g/mol. Its IUPAC name is ethyl (1S,2R,6S,7S,9S)-9-hydroxy-5-oxo-4-phenyltricyclo[5.2.1.02,6]dec-3-ene-3-carboxylate.
| Compound Name | ethyl (1S,2R,6S,7S,9S)-9-hydroxy-5-oxo-4-phenyltricyclo[5.2.1.02,6]dec-3-ene-3-carboxylate |
|---|---|
| PubChem CID | 101103644 |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | ethyl (1S,2R,6S,7S,9S)-9-hydroxy-5-oxo-4-phenyltricyclo[5.2.1.02,6]dec-3-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)C(=O)[C@H]2[C@H]3C[C@@H]([C@@H]12)[C@@H](O)C3 |
| InChI | InChI=1S/C19H20O4/c1-2-23-19(22)17-14(10-6-4-3-5-7-10)18(21)15-11-8-12(16(15)17)13(20)9-11/h3-7,11-13,15-16,20H,2,8-9H2,1H3/t11-,12+,13-,15-,16+/m0/s1 |
| InChIKey | MPVFXEPIUPVWTE-KUCCMMOJSA-N |
| XLogP | 2.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |