C20H22O4 — CID 101083927
3-O-ethyl 8-O-methyl (1R,2S,5R,6R,8R)-4-phenyltricyclo[4.2.1.02,5]non-3-ene-3,8-dicarboxylate (PubChem CID 101083927) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is 3-O-ethyl 8-O-methyl (1R,2S,5R,6R,8R)-4-phenyltricyclo[4.2.1.02,5]non-3-ene-3,8-dicarboxylate.
| Compound Name | 3-O-ethyl 8-O-methyl (1R,2S,5R,6R,8R)-4-phenyltricyclo[4.2.1.02,5]non-3-ene-3,8-dicarboxylate |
|---|---|
| PubChem CID | 101083927 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 3-O-ethyl 8-O-methyl (1R,2S,5R,6R,8R)-4-phenyltricyclo[4.2.1.02,5]non-3-ene-3,8-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)[C@@H]2[C@@H]3C[C@H]([C@H]12)[C@H](C(=O)OC)C3 |
| InChI | InChI=1S/C20H22O4/c1-3-24-20(22)18-15(11-7-5-4-6-8-11)16-12-9-13(17(16)18)14(10-12)19(21)23-2/h4-8,12-14,16-17H,3,9-10H2,1-2H3/t12-,13+,14-,16+,17+/m1/s1 |
| InChIKey | ZRQATARHURDQPN-VUBIOHBQSA-N |
| XLogP | 3.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |