C26H20N4O4S2 — CID 101438201
(3S,4S)-2,5-bis(4-nitrophenyl)-3,4-diphenyl-1-sulfanylidene-1,2,5-thiadiazolidine (PubChem CID 101438201) has the molecular formula C26H20N4O4S2 and a molecular weight of 516.60 g/mol. Its IUPAC name is (3S,4S)-2,5-bis(4-nitrophenyl)-3,4-diphenyl-1-sulfanylidene-1,2,5-thiadiazolidine.
| Compound Name | (3S,4S)-2,5-bis(4-nitrophenyl)-3,4-diphenyl-1-sulfanylidene-1,2,5-thiadiazolidine |
|---|---|
| PubChem CID | 101438201 |
| Molecular Formula | C26H20N4O4S2 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.09 |
| IUPAC Name | (3S,4S)-2,5-bis(4-nitrophenyl)-3,4-diphenyl-1-sulfanylidene-1,2,5-thiadiazolidine |
| SMILES | O=[N+]([O-])c1ccc(N2[C@@H](c3ccccc3)[C@H](c3ccccc3)N(c3ccc([N+](=O)[O-])cc3)S2=S)cc1 |
| InChI | InChI=1S/C26H20N4O4S2/c31-29(32)23-15-11-21(12-16-23)27-25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)28(36(27)35)22-13-17-24(18-14-22)30(33)34/h1-18,25-26H/t25-,26-/m0/s1 |
| InChIKey | JPUISLLKIPBGFL-UIOOFZCWSA-N |
| XLogP | 6.22 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|