C35H30N2O6 — CID 11296099
dimethyl (2S,3S,3aS,6R,6aR)-2-(4-nitrophenyl)-1,3,6-triphenyl-2,3,3a,6-tetrahydrocyclopenta[b]pyrrole-4,6a-dicarboxylate (PubChem CID 11296099) has the molecular formula C35H30N2O6 and a molecular weight of 574.63 g/mol. Its IUPAC name is dimethyl (2S,3S,3aS,6R,6aR)-2-(4-nitrophenyl)-1,3,6-triphenyl-2,3,3a,6-tetrahydrocyclopenta[b]pyrrole-4,6a-dicarboxylate.
| Compound Name | dimethyl (2S,3S,3aS,6R,6aR)-2-(4-nitrophenyl)-1,3,6-triphenyl-2,3,3a,6-tetrahydrocyclopenta[b]pyrrole-4,6a-dicarboxylate |
|---|---|
| PubChem CID | 11296099 |
| Molecular Formula | C35H30N2O6 |
| Molecular Weight | 574.63 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | dimethyl (2S,3S,3aS,6R,6aR)-2-(4-nitrophenyl)-1,3,6-triphenyl-2,3,3a,6-tetrahydrocyclopenta[b]pyrrole-4,6a-dicarboxylate |
| SMILES | COC(=O)C1=C[C@H](c2ccccc2)[C@]2(C(=O)OC)[C@H]1[C@@H](c1ccccc1)[C@@H](c1ccc([N+](=O)[O-])cc1)N2c1ccccc1 |
| InChI | InChI=1S/C35H30N2O6/c1-42-33(38)28-22-29(23-12-6-3-7-13-23)35(34(39)43-2)31(28)30(24-14-8-4-9-15-24)32(36(35)26-16-10-5-11-17-26)25-18-20-27(21-19-25)37(40)41/h3-22,29-32H,1-2H3/t29-,30-,31-,32-,35-/m1/s1 |
| InChIKey | HWCVQYYHGJOZLT-PVEIOGNQSA-N |
| XLogP | 6.36 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|