C23H24N2O4 — CID 101242663
ethyl (3R,3aS)-2-(4-nitrophenyl)-3-phenyl-3,3a,4,5,6,7-hexahydroisoindole-1-carboxylate (PubChem CID 101242663) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethyl (3R,3aS)-2-(4-nitrophenyl)-3-phenyl-3,3a,4,5,6,7-hexahydroisoindole-1-carboxylate.
| Compound Name | ethyl (3R,3aS)-2-(4-nitrophenyl)-3-phenyl-3,3a,4,5,6,7-hexahydroisoindole-1-carboxylate |
|---|---|
| PubChem CID | 101242663 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | ethyl (3R,3aS)-2-(4-nitrophenyl)-3-phenyl-3,3a,4,5,6,7-hexahydroisoindole-1-carboxylate |
| SMILES | CCOC(=O)C1=C2CCCC[C@@H]2[C@H](c2ccccc2)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H24N2O4/c1-2-29-23(26)22-20-11-7-6-10-19(20)21(16-8-4-3-5-9-16)24(22)17-12-14-18(15-13-17)25(27)28/h3-5,8-9,12-15,19,21H,2,6-7,10-11H2,1H3/t19-,21-/m0/s1 |
| InChIKey | RPLKYRIWHYZQHS-FPOVZHCZSA-N |
| XLogP | 5.16 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|