C18H19N3O7 — CID 15505761
dimethyl 3,3-dimethyl-5-(4-nitrophenyl)-1-oxo-2,5-dihydropyrazolo[1,2-a]pyrazole-6,7-dicarboxylate (PubChem CID 15505761) has the molecular formula C18H19N3O7 and a molecular weight of 389.36 g/mol. Its IUPAC name is dimethyl 3,3-dimethyl-5-(4-nitrophenyl)-1-oxo-2,5-dihydropyrazolo[1,2-a]pyrazole-6,7-dicarboxylate.
| Compound Name | dimethyl 3,3-dimethyl-5-(4-nitrophenyl)-1-oxo-2,5-dihydropyrazolo[1,2-a]pyrazole-6,7-dicarboxylate |
|---|---|
| PubChem CID | 15505761 |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | dimethyl 3,3-dimethyl-5-(4-nitrophenyl)-1-oxo-2,5-dihydropyrazolo[1,2-a]pyrazole-6,7-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(=O)CC(C)(C)N2C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N3O7/c1-18(2)9-12(22)19-15(17(24)28-4)13(16(23)27-3)14(20(18)19)10-5-7-11(8-6-10)21(25)26/h5-8,14H,9H2,1-4H3 |
| InChIKey | JRARDTWWTACOEO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|