C14H13F3N2O2 — CID 57256067
2,6-dimethyl-5-nitro-4-[4-(trifluoromethyl)phenyl]-3,4-dihydropyridine (PubChem CID 57256067) has the molecular formula C14H13F3N2O2 and a molecular weight of 298.26 g/mol. Its IUPAC name is 2,6-dimethyl-5-nitro-4-[4-(trifluoromethyl)phenyl]-3,4-dihydropyridine.
| Compound Name | 2,6-dimethyl-5-nitro-4-[4-(trifluoromethyl)phenyl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 57256067 |
| Molecular Formula | C14H13F3N2O2 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 2,6-dimethyl-5-nitro-4-[4-(trifluoromethyl)phenyl]-3,4-dihydropyridine |
| SMILES | CC1=NC(C)=C([N+](=O)[O-])C(c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C14H13F3N2O2/c1-8-7-12(13(19(20)21)9(2)18-8)10-3-5-11(6-4-10)14(15,16)17/h3-6,12H,7H2,1-2H3 |
| InChIKey | HNXJFBXBWKEALW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|