C20H17F3N2O3 — CID 53375340
(2S,3S)-3,5-dimethyl-1-(4-nitrophenyl)-2-[4-(trifluoromethyl)phenyl]-2,3-dihydropyridin-4-one (PubChem CID 53375340) has the molecular formula C20H17F3N2O3 and a molecular weight of 390.36 g/mol. Its IUPAC name is (2S,3S)-3,5-dimethyl-1-(4-nitrophenyl)-2-[4-(trifluoromethyl)phenyl]-2,3-dihydropyridin-4-one.
| Compound Name | (2S,3S)-3,5-dimethyl-1-(4-nitrophenyl)-2-[4-(trifluoromethyl)phenyl]-2,3-dihydropyridin-4-one |
|---|---|
| PubChem CID | 53375340 |
| Molecular Formula | C20H17F3N2O3 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (2S,3S)-3,5-dimethyl-1-(4-nitrophenyl)-2-[4-(trifluoromethyl)phenyl]-2,3-dihydropyridin-4-one |
| SMILES | CC1=CN(c2ccc([N+](=O)[O-])cc2)C(c2ccc(C(F)(F)F)cc2)[C@H](C)C1=O |
| InChI | InChI=1S/C20H17F3N2O3/c1-12-11-24(16-7-9-17(10-8-16)25(27)28)18(13(2)19(12)26)14-3-5-15(6-4-14)20(21,22)23/h3-11,13,18H,1-2H3/t13-,18?/m0/s1 |
| InChIKey | PDKVGRVQWRRINH-FVRDMJKUSA-N |
| XLogP | 5.28 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|