C20H17F3N4O3 — CID 3597880
2-(4-nitrophenyl)-5-(trifluoromethyl)-4-[(2,4,6-trimethylphenyl)iminomethyl]-1H-pyrazol-3-one (PubChem CID 3597880) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-5-(trifluoromethyl)-4-[(2,4,6-trimethylphenyl)iminomethyl]-1H-pyrazol-3-one.
| Compound Name | 2-(4-nitrophenyl)-5-(trifluoromethyl)-4-[(2,4,6-trimethylphenyl)iminomethyl]-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 3597880 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-(4-nitrophenyl)-5-(trifluoromethyl)-4-[(2,4,6-trimethylphenyl)iminomethyl]-1H-pyrazol-3-one |
| SMILES | Cc1cc(C)c(/N=C/c2c(C(F)(F)F)[nH]n(-c3ccc([N+](=O)[O-])cc3)c2=O)c(C)c1 |
| InChI | InChI=1S/C20H17F3N4O3/c1-11-8-12(2)17(13(3)9-11)24-10-16-18(20(21,22)23)25-26(19(16)28)14-4-6-15(7-5-14)27(29)30/h4-10,25H,1-3H3/b24-10+ |
| InChIKey | DGCMTUHJIRUBAQ-YSURURNPSA-N |
| XLogP | 4.77 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|