C18H15N5O5 — CID 137074209
4-[(3,5-dinitrophenyl)iminomethyl]-5-methyl-2-(3-methylphenyl)-1H-pyrazol-3-one (PubChem CID 137074209) has the molecular formula C18H15N5O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is 4-[(3,5-dinitrophenyl)iminomethyl]-5-methyl-2-(3-methylphenyl)-1H-pyrazol-3-one.
| Compound Name | 4-[(3,5-dinitrophenyl)iminomethyl]-5-methyl-2-(3-methylphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137074209 |
| Molecular Formula | C18H15N5O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 4-[(3,5-dinitrophenyl)iminomethyl]-5-methyl-2-(3-methylphenyl)-1H-pyrazol-3-one |
| SMILES | Cc1cccc(-n2[nH]c(C)c(/C=N/c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c2=O)c1 |
| InChI | InChI=1S/C18H15N5O5/c1-11-4-3-5-14(6-11)21-18(24)17(12(2)20-21)10-19-13-7-15(22(25)26)9-16(8-13)23(27)28/h3-10,20H,1-2H3/b19-10+ |
| InChIKey | MYOQBCIMDFTSGU-VXLYETTFSA-N |
| XLogP | 3.35 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|