C23H22N6O3 — CID 137020640
4-[[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]iminomethyl]-5-methyl-2-(3-methylphenyl)-1H-pyrazol-3-one (PubChem CID 137020640) has the molecular formula C23H22N6O3 and a molecular weight of 430.47 g/mol. Its IUPAC name is 4-[[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]iminomethyl]-5-methyl-2-(3-methylphenyl)-1H-pyrazol-3-one.
| Compound Name | 4-[[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]iminomethyl]-5-methyl-2-(3-methylphenyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137020640 |
| Molecular Formula | C23H22N6O3 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 4-[[3,5-dimethyl-1-(4-nitrophenyl)pyrazol-4-yl]iminomethyl]-5-methyl-2-(3-methylphenyl)-1H-pyrazol-3-one |
| SMILES | Cc1cccc(-n2[nH]c(C)c(/C=N/c3c(C)nn(-c4ccc([N+](=O)[O-])cc4)c3C)c2=O)c1 |
| InChI | InChI=1S/C23H22N6O3/c1-14-6-5-7-20(12-14)28-23(30)21(15(2)25-28)13-24-22-16(3)26-27(17(22)4)18-8-10-19(11-9-18)29(31)32/h5-13,25H,1-4H3/b24-13+ |
| InChIKey | BBALVVIZDRRLOY-ZMOGYAJESA-N |
| XLogP | 4.24 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|