C31H35F3N4O6 — CID 54079835
3-O-propan-2-yl 5-O-[2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54079835) has the molecular formula C31H35F3N4O6 and a molecular weight of 616.64 g/mol. Its IUPAC name is 3-O-propan-2-yl 5-O-[2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-propan-2-yl 5-O-[2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54079835 |
| Molecular Formula | C31H35F3N4O6 |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 616.25 |
| IUPAC Name | 3-O-propan-2-yl 5-O-[2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl] 2,6-dimethyl-4-(4-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=NC(C)=C(C(=O)OCCN2CCN(c3ccc(C(F)(F)F)cc3)CC2)C(c2ccc([N+](=O)[O-])cc2)C1C(=O)OC(C)C |
| InChI | InChI=1S/C31H35F3N4O6/c1-19(2)44-30(40)27-21(4)35-20(3)26(28(27)22-5-9-25(10-6-22)38(41)42)29(39)43-18-17-36-13-15-37(16-14-36)24-11-7-23(8-12-24)31(32,33)34/h5-12,19,27-28H,13-18H2,1-4H3 |
| InChIKey | MMHTVKQHMFZUIN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 114.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|