C29H34N4O7 — CID 54463751
5-O-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 54463751) has the molecular formula C29H34N4O7 and a molecular weight of 550.61 g/mol. Its IUPAC name is 5-O-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 54463751 |
| Molecular Formula | C29H34N4O7 |
| Molecular Weight | 550.61 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 5-O-[2-[4-(4-methoxyphenyl)piperazin-1-yl]ethyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1C(C)=NC(C)=C(C(=O)OCCN2CCN(c3ccc(OC)cc3)CC2)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C29H34N4O7/c1-19-25(28(34)39-4)27(21-6-5-7-23(18-21)33(36)37)26(20(2)30-19)29(35)40-17-16-31-12-14-32(15-13-31)22-8-10-24(38-3)11-9-22/h5-11,18,25,27H,12-17H2,1-4H3 |
| InChIKey | XDKQARIJPNIIFJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 123.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|