C11H7N5O4 — CID 135420612
4-(4,7-dioxo-5,6-dihydrotriazolo[4,5-d]pyridazin-3-yl)benzoic acid (PubChem CID 135420612) has the molecular formula C11H7N5O4 and a molecular weight of 273.21 g/mol. Its IUPAC name is 4-(4,7-dioxo-5,6-dihydrotriazolo[4,5-d]pyridazin-3-yl)benzoic acid.
| Compound Name | 4-(4,7-dioxo-5,6-dihydrotriazolo[4,5-d]pyridazin-3-yl)benzoic acid |
|---|---|
| PubChem CID | 135420612 |
| Molecular Formula | C11H7N5O4 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 4-(4,7-dioxo-5,6-dihydrotriazolo[4,5-d]pyridazin-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-n2nnc3c(=O)[nH][nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C11H7N5O4/c17-9-7-8(10(18)14-13-9)16(15-12-7)6-3-1-5(2-4-6)11(19)20/h1-4H,(H,13,17)(H,14,18)(H,19,20) |
| InChIKey | HIQWJRDLVWHUJR-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |