C11H5N3O5 — CID 82369565
4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid (PubChem CID 82369565) has the molecular formula C11H5N3O5 and a molecular weight of 259.18 g/mol. Its IUPAC name is 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid.
| Compound Name | 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid |
|---|---|
| PubChem CID | 82369565 |
| Molecular Formula | C11H5N3O5 |
| Molecular Weight | 259.18 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid |
| SMILES | O=C(O)c1ccc(-n2nnc3c2C(=O)OC3=O)cc1 |
| InChI | InChI=1S/C11H5N3O5/c15-9(16)5-1-3-6(4-2-5)14-8-7(12-13-14)10(17)19-11(8)18/h1-4H,(H,15,16) |
| InChIKey | OSWCOZDVIVNVAG-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|