4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid

C11H5N3O5 — CID 82369565

IUPAC4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid
SMILESO=C(O)c1ccc(-n2nnc3c2C(=O)OC3=O)cc1
InChIInChI=1S/C11H5N3O5/c15-9(16)5-1-3-6(4-2-5)14-8-7(12-13-14)10(17)19-11(8)18/h1-4H,(H,15,16)
InChIKeyOSWCOZDVIVNVAG-UHFFFAOYSA-N
MW259.18 g/mol
LogP0.28
Rot. Bonds2

About 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid

4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid (PubChem CID 82369565) has the molecular formula C11H5N3O5 and a molecular weight of 259.18 g/mol. Its IUPAC name is 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid.

Molecular Properties

Compound Name4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid
PubChem CID82369565
Molecular FormulaC11H5N3O5
Molecular Weight259.18 g/mol
Exact Mass259.02
IUPAC Name4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid
SMILESO=C(O)c1ccc(-n2nnc3c2C(=O)OC3=O)cc1
InChIInChI=1S/C11H5N3O5/c15-9(16)5-1-3-6(4-2-5)14-8-7(12-13-14)10(17)19-11(8)18/h1-4H,(H,15,16)
InChIKeyOSWCOZDVIVNVAG-UHFFFAOYSA-N
XLogP0.28
TPSA111.38 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.18
LogP ≤ 50.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid?
The IUPAC name of 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid (CID 82369565) is 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid.
What is the SMILES notation for 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid?
The canonical SMILES for 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid is O=C(O)c1ccc(-n2nnc3c2C(=O)OC3=O)cc1.
What is the InChIKey of 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid?
The InChIKey is OSWCOZDVIVNVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5N3O5/c15-9(16)5-1-3-6(4-2-5)14-8-7(12-13-14)10(17)19-11(8)18/h1-4H,(H,15,16).
What are the key properties of 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid?
4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid has a molecular weight of 259.18 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,6-dioxofuro[3,4-d]triazol-3-yl)benzoic acid is sourced from PubChem (CID 82369565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).