C11H7N3O4 — CID 82369496
3-(4-methoxyphenyl)furo[3,4-d]triazole-4,6-dione (PubChem CID 82369496) has the molecular formula C11H7N3O4 and a molecular weight of 245.19 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)furo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-(4-methoxyphenyl)furo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 82369496 |
| Molecular Formula | C11H7N3O4 |
| Molecular Weight | 245.19 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 3-(4-methoxyphenyl)furo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc(-n2nnc3c2C(=O)OC3=O)cc1 |
| InChI | InChI=1S/C11H7N3O4/c1-17-7-4-2-6(3-5-7)14-9-8(12-13-14)10(15)18-11(9)16/h2-5H,1H3 |
| InChIKey | KHIZYPYGCUCUGD-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|