C11H6ClN3O4 — CID 82369550
3-(5-chloro-2-methoxyphenyl)furo[3,4-d]triazole-4,6-dione (PubChem CID 82369550) has the molecular formula C11H6ClN3O4 and a molecular weight of 279.64 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)furo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-(5-chloro-2-methoxyphenyl)furo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 82369550 |
| Molecular Formula | C11H6ClN3O4 |
| Molecular Weight | 279.64 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)furo[3,4-d]triazole-4,6-dione |
| SMILES | COc1ccc(Cl)cc1-n1nnc2c1C(=O)OC2=O |
| InChI | InChI=1S/C11H6ClN3O4/c1-18-7-3-2-5(12)4-6(7)15-9-8(13-14-15)10(16)19-11(9)17/h2-4H,1H3 |
| InChIKey | ULZYKMSNGNGIED-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.64 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|