C10H4ClN3O3 — CID 82369568
3-(3-chlorophenyl)furo[3,4-d]triazole-4,6-dione (PubChem CID 82369568) has the molecular formula C10H4ClN3O3 and a molecular weight of 249.61 g/mol. Its IUPAC name is 3-(3-chlorophenyl)furo[3,4-d]triazole-4,6-dione.
| Compound Name | 3-(3-chlorophenyl)furo[3,4-d]triazole-4,6-dione |
|---|---|
| PubChem CID | 82369568 |
| Molecular Formula | C10H4ClN3O3 |
| Molecular Weight | 249.61 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 3-(3-chlorophenyl)furo[3,4-d]triazole-4,6-dione |
| SMILES | O=C1OC(=O)c2c1nnn2-c1cccc(Cl)c1 |
| InChI | InChI=1S/C10H4ClN3O3/c11-5-2-1-3-6(4-5)14-8-7(12-13-14)9(15)17-10(8)16/h1-4H |
| InChIKey | IDEPKGIIYVDDIP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.61 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|