C13H12ClN3O2S — CID 82420534
1-(5-chloro-2-methoxyphenyl)-6-methyl-4-oxopyridazine-3-carbothioamide (PubChem CID 82420534) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-6-methyl-4-oxopyridazine-3-carbothioamide.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-6-methyl-4-oxopyridazine-3-carbothioamide |
|---|---|
| PubChem CID | 82420534 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-6-methyl-4-oxopyridazine-3-carbothioamide |
| SMILES | COc1ccc(Cl)cc1-n1nc(C(N)=S)c(=O)cc1C |
| InChI | InChI=1S/C13H12ClN3O2S/c1-7-5-10(18)12(13(15)20)16-17(7)9-6-8(14)3-4-11(9)19-2/h3-6H,1-2H3,(H2,15,20) |
| InChIKey | PFZWCDNSVPWGIF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|