C14H13ClN2O4 — CID 82419046
1-(3,4-dimethoxyphenyl)-6-methyl-4-oxopyridazine-3-carbonyl chloride (PubChem CID 82419046) has the molecular formula C14H13ClN2O4 and a molecular weight of 308.72 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-6-methyl-4-oxopyridazine-3-carbonyl chloride.
| Compound Name | 1-(3,4-dimethoxyphenyl)-6-methyl-4-oxopyridazine-3-carbonyl chloride |
|---|---|
| PubChem CID | 82419046 |
| Molecular Formula | C14H13ClN2O4 |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-6-methyl-4-oxopyridazine-3-carbonyl chloride |
| SMILES | COc1ccc(-n2nc(C(=O)Cl)c(=O)cc2C)cc1OC |
| InChI | InChI=1S/C14H13ClN2O4/c1-8-6-10(18)13(14(15)19)16-17(8)9-4-5-11(20-2)12(7-9)21-3/h4-7H,1-3H3 |
| InChIKey | UBEOCMVTGSRCFP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|