About 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one
3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one (PubChem CID 82421210) has the molecular formula C15H16N2O2
and a molecular weight of 256.30 g/mol. Its IUPAC name is 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one.
Molecular Properties
| Compound Name | 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one |
| PubChem CID | 82421210 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one |
| SMILES | CC(=O)c1nn(-c2ccc(C)c(C)c2)c(C)cc1=O |
| InChI | InChI=1S/C15H16N2O2/c1-9-5-6-13(7-10(9)2)17-11(3)8-14(19)15(16-17)12(4)18/h5-8H,1-4H3 |
| InChIKey | XKHIAZIPSHGJFC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one?
The IUPAC name of 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one (CID 82421210) is 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one.
What is the SMILES notation for 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one?
The canonical SMILES for 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one is CC(=O)c1nn(-c2ccc(C)c(C)c2)c(C)cc1=O.
What is the InChIKey of 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one?
The InChIKey is XKHIAZIPSHGJFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O2/c1-9-5-6-13(7-10(9)2)17-11(3)8-14(19)15(16-17)12(4)18/h5-8H,1-4H3.
What are the key properties of 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one?
3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one has a molecular weight of 256.30 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-1-(3,4-dimethylphenyl)-6-methylpyridazin-4-one is sourced from PubChem (CID 82421210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).