C8H6N4Na2O2S — CID 69308828
CID 69308828 (PubChem CID 69308828) has the molecular formula C8H6N4Na2O2S and a molecular weight of 268.21 g/mol.
| Compound Name | CID 69308828 |
|---|---|
| PubChem CID | 69308828 |
| Molecular Formula | C8H6N4Na2O2S |
| Molecular Weight | 268.21 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | — |
| SMILES | O=C(O)c1ccc(-n2[nH]nnc2=S)cc1.[Na].[Na] |
| InChI | InChI=1S/C8H6N4O2S.2Na/c13-7(14)5-1-3-6(4-2-5)12-8(15)9-10-11-12;;/h1-4H,(H,13,14)(H,9,11,15);; |
| InChIKey | YGBWYZBRFNSSLG-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|