C20H21ClN6O2S — CID 22265215
1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenoxy]ethanone (PubChem CID 22265215) has the molecular formula C20H21ClN6O2S and a molecular weight of 444.95 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenoxy]ethanone.
| Compound Name | 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenoxy]ethanone |
|---|---|
| PubChem CID | 22265215 |
| Molecular Formula | C20H21ClN6O2S |
| Molecular Weight | 444.95 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-[4-(5-sulfanylidene-2H-tetrazol-1-yl)phenoxy]ethanone |
| SMILES | O=C(COc1ccc(-n2[nH]nnc2=S)cc1)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H21ClN6O2S/c21-16-3-1-15(2-4-16)13-25-9-11-26(12-10-25)19(28)14-29-18-7-5-17(6-8-18)27-20(30)22-23-24-27/h1-8H,9-14H2,(H,22,24,30) |
| InChIKey | HXSONQQWNJWRET-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.95 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|