C22H22ClN3O4 — CID 22265170
5-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-1H-indole-3-carboxylic acid (PubChem CID 22265170) has the molecular formula C22H22ClN3O4 and a molecular weight of 427.89 g/mol. Its IUPAC name is 5-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-1H-indole-3-carboxylic acid.
| Compound Name | 5-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-1H-indole-3-carboxylic acid |
|---|---|
| PubChem CID | 22265170 |
| Molecular Formula | C22H22ClN3O4 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | 5-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]-1H-indole-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2ccc(OCC(=O)N3CCN(Cc4ccc(Cl)cc4)CC3)cc12 |
| InChI | InChI=1S/C22H22ClN3O4/c23-16-3-1-15(2-4-16)13-25-7-9-26(10-8-25)21(27)14-30-17-5-6-20-18(11-17)19(12-24-20)22(28)29/h1-6,11-12,24H,7-10,13-14H2,(H,28,29) |
| InChIKey | MRENEDFXVARPDA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |