C27H28N10O6 — CID 157452566
5-amino-3-(3-nitrophenyl)-1-propan-2-ylpyrazole-4-carboxamide;3-(3-nitrophenyl)-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 157452566) has the molecular formula C27H28N10O6 and a molecular weight of 588.59 g/mol. Its IUPAC name is 5-amino-3-(3-nitrophenyl)-1-propan-2-ylpyrazole-4-carboxamide;3-(3-nitrophenyl)-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 5-amino-3-(3-nitrophenyl)-1-propan-2-ylpyrazole-4-carboxamide;3-(3-nitrophenyl)-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 157452566 |
| Molecular Formula | C27H28N10O6 |
| Molecular Weight | 588.59 g/mol |
| Exact Mass | 588.22 |
| IUPAC Name | 5-amino-3-(3-nitrophenyl)-1-propan-2-ylpyrazole-4-carboxamide;3-(3-nitrophenyl)-1-propan-2-yl-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | CC(C)n1nc(-c2cccc([N+](=O)[O-])c2)c(C(N)=O)c1N.CC(C)n1nc(-c2cccc([N+](=O)[O-])c2)c2c(=O)[nH]cnc21 |
| InChI | InChI=1S/C14H13N5O3.C13H15N5O3/c1-8(2)18-13-11(14(20)16-7-15-13)12(17-18)9-4-3-5-10(6-9)19(21)22;1-7(2)17-12(14)10(13(15)19)11(16-17)8-4-3-5-9(6-8)18(20)21/h3-8H,1-2H3,(H,15,16,20);3-7H,14H2,1-2H3,(H2,15,19) |
| InChIKey | BSYXDLSIMPUTDV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 236.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.59 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|